1,3-Dimethyl-5-(2-methylpropyl)-5-(2-propenyl)-2,4,6(1H,3H,5H)-pyrimidinetrione structure
|
Common Name | 1,3-Dimethyl-5-(2-methylpropyl)-5-(2-propenyl)-2,4,6(1H,3H,5H)-pyrimidinetrione | ||
|---|---|---|---|---|
| CAS Number | 55045-04-0 | Molecular Weight | 252.30900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H20N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,3-dimethyl-5-(2-methylpropyl)-5-prop-2-enyl-1,3-diazinane-2,4,6-trione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H20N2O3 |
|---|---|
| Molecular Weight | 252.30900 |
| Exact Mass | 252.14700 |
| PSA | 57.69000 |
| LogP | 1.52120 |
| InChIKey | GDEXVBXMOVNKKD-UHFFFAOYSA-N |
| SMILES | C=CCC1(CC(C)C)C(=O)N(C)C(=O)N(C)C1=O |
| HS Code | 2933540000 |
|---|
| HS Code | 2933540000 |
|---|---|
| Summary | 2933540000 other derivatives of malonylurea (barbituric acid); salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 1,3-Dimethyl derivative of Butalbital |