Ricinoleic acid ethyl ester structure
|
Common Name | Ricinoleic acid ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 55066-53-0 | Molecular Weight | 326.5 | |
| Density | 0.92 | Boiling Point | 258 °C / 13mmHg | |
| Molecular Formula | C20H38O3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 159.1ºC | |
Use of Ricinoleic acid ethyl ester(R,Z)-Ethyl 12-hydroxyoctadec-9-enoate is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | Ethyl Ricinoleate |
|---|---|
| Synonym | More Synonyms |
| Description | (R,Z)-Ethyl 12-hydroxyoctadec-9-enoate is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog |
| Density | 0.92 |
|---|---|
| Boiling Point | 258 °C / 13mmHg |
| Molecular Formula | C20H38O3 |
| Molecular Weight | 326.5 |
| Flash Point | 159.1ºC |
| Exact Mass | 326.28209507 |
| PSA | 46.53000 |
| LogP | 5.94790 |
| Index of Refraction | 1.466 |
| InChIKey | AZXVZUBIFYQWJK-KWRJMZDGSA-N |
| SMILES | CCCCCC[C@H](C/C=CCCCCCCCC(=O)OCC)O |
| Storage condition | −20°C |
| Personal Protective Equipment | Eyeshields;Gloves |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 2 |
| HS Code | 2918199090 |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Ethyl ricinoleate |
| EINECS 259-462-9 |
| MFCD00037812 |