1-[3-(4-chlorophenyl)prop-2-enyl]piperazine
![1-[3-(4-chlorophenyl)prop-2-enyl]piperazine Structure](https://image.chemsrc.com/caspic/251/55077-71-9.png)
1-[3-(4-chlorophenyl)prop-2-enyl]piperazine structure
|
Common Name | 1-[3-(4-chlorophenyl)prop-2-enyl]piperazine | ||
|---|---|---|---|---|
| CAS Number | 55077-71-9 | Molecular Weight | 236.74000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H17ClN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-[3-(4-chlorophenyl)prop-2-enyl]piperazine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H17ClN2 |
|---|---|
| Molecular Weight | 236.74000 |
| Exact Mass | 236.10800 |
| PSA | 15.27000 |
| LogP | 2.52510 |
| InChIKey | TZFGWKFKCBLDGS-UHFFFAOYSA-N |
| SMILES | Clc1ccc(C=CCN2CCNCC2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1-[3-(4-chlorop... CAS#:55077-71-9 |
| Literature: Gao, Feng-Li; Wang, Xin; Zhang, Hong-Mei; Cheng, Tie-Ming; Li, Run-Tao Bioorganic and Medicinal Chemistry Letters, 2003 , vol. 13, # 9 p. 1535 - 1537 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Piperazine,1-[3-(4-chlorophenyl)-2-propenyl] |
| 1-[3-(4-chlorophenyl)-allyl]-piperazine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 1-[3-(4-chlorophenyl)prop-2-enyl]piperazine? |
| A: LogP of 1-[3-(4-chlorophenyl)prop-2-enyl]piperazine is 2.52510. |
| Q: What is the SMILES notation of 1-[3-(4-chlorophenyl)prop-2-enyl]piperazine? |
| A: SMILES notation of 1-[3-(4-chlorophenyl)prop-2-enyl]piperazine is Clc1ccc(C=CCN2CCNCC2)cc1. |
| Q: What is the molecular formula of 1-[3-(4-chlorophenyl)prop-2-enyl]piperazine? |
| A: Molecular formula of 1-[3-(4-chlorophenyl)prop-2-enyl]piperazine is C13H17ClN2. |
| Q: What English synonyms does 1-[3-(4-chlorophenyl)prop-2-enyl]piperazine have? |
| A: English synonyms of 1-[3-(4-chlorophenyl)prop-2-enyl]piperazine: Piperazine,1-[3-(4-chlorophenyl)-2-propenyl], 1-[3-(4-chlorophenyl)-allyl]-piperazine. |
| Q: What is the polar surface area (PSA) of 1-[3-(4-chlorophenyl)prop-2-enyl]piperazine? |
| A: Polar surface area (PSA) of 1-[3-(4-chlorophenyl)prop-2-enyl]piperazine is 15.27000. |
| Q: What is the InChIKey of 1-[3-(4-chlorophenyl)prop-2-enyl]piperazine? |
| A: InChIKey of 1-[3-(4-chlorophenyl)prop-2-enyl]piperazine is TZFGWKFKCBLDGS-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 55077-71-9? |
| A: Chinese name of 55077-71-9 is 55077-71-9. |
| Q: What is the CAS number of 1-[3-(4-chlorophenyl)prop-2-enyl]piperazine? |
| A: CAS number of 1-[3-(4-chlorophenyl)prop-2-enyl]piperazine is 55077-71-9. |
| Q: What is the molecular weight of 1-[3-(4-chlorophenyl)prop-2-enyl]piperazine? |
| A: Molecular weight of 1-[3-(4-chlorophenyl)prop-2-enyl]piperazine is 236.74000. |
| Q: What is the English name of 1-[3-(4-chlorophenyl)prop-2-enyl]piperazine? |
| A: The English name of 1-[3-(4-chlorophenyl)prop-2-enyl]piperazine is 1-[3-(4-chlorophenyl)prop-2-enyl]piperazine. |