2-Cyano-3,5-dimethoxybenzeneacetic acid
Modify Date: 2025-09-10 00:18:35
2-Cyano-3,5-dimethoxybenzeneacetic acid structure
|
Common Name | 2-Cyano-3,5-dimethoxybenzeneacetic acid | ||
|---|---|---|---|---|
| CAS Number | 55086-20-9 | Molecular Weight | 221.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Cyano-3,5-dimethoxybenzeneacetic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H11NO4 |
|---|---|
| Molecular Weight | 221.21 |
| InChIKey | KIRNAXFCNBITMK-UHFFFAOYSA-N |
| SMILES | COc1cc(CC(=O)O)c(C#N)c(OC)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2-Cyano-3,5-dimethoxybenzeneacetic acid? |
| A: Molecular formula of 2-Cyano-3,5-dimethoxybenzeneacetic acid is C11H11NO4. |
| Q: What is the Chinese name of 55086-20-9? |
| A: Chinese name of 55086-20-9 is 55086-20-9. |
| Q: What is the CAS number of 2-Cyano-3,5-dimethoxybenzeneacetic acid? |
| A: CAS number of 2-Cyano-3,5-dimethoxybenzeneacetic acid is 55086-20-9. |
| Q: What is the InChIKey of 2-Cyano-3,5-dimethoxybenzeneacetic acid? |
| A: InChIKey of 2-Cyano-3,5-dimethoxybenzeneacetic acid is KIRNAXFCNBITMK-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 2-Cyano-3,5-dimethoxybenzeneacetic acid? |
| A: Molecular weight of 2-Cyano-3,5-dimethoxybenzeneacetic acid is 221.21. |
| Q: What is the SMILES notation of 2-Cyano-3,5-dimethoxybenzeneacetic acid? |
| A: SMILES notation of 2-Cyano-3,5-dimethoxybenzeneacetic acid is COc1cc(CC(=O)O)c(C#N)c(OC)c1. |
| Q: What is the English name of 2-Cyano-3,5-dimethoxybenzeneacetic acid? |
| A: The English name of 2-Cyano-3,5-dimethoxybenzeneacetic acid is 2-Cyano-3,5-dimethoxybenzeneacetic acid. |