2,7-Diiodoxanthone
Modify Date: 2025-09-03 21:28:16
2,7-Diiodoxanthone structure
|
Common Name | 2,7-Diiodoxanthone | ||
|---|---|---|---|---|
| CAS Number | 55103-03-2 | Molecular Weight | 447.99 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H6I2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,7-Diiodoxanthone |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H6I2O2 |
|---|---|
| Molecular Weight | 447.99 |
| InChIKey | GATAYWCCGFGSAI-UHFFFAOYSA-N |
| SMILES | O=c1c2cc(I)ccc2oc2ccc(I)cc12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2,7-Diiodoxanthone? |
| A: SMILES notation of 2,7-Diiodoxanthone is O=c1c2cc(I)ccc2oc2ccc(I)cc12. |
| Q: What is the English name of 2,7-Diiodoxanthone? |
| A: The English name of 2,7-Diiodoxanthone is 2,7-Diiodoxanthone. |
| Q: What is the molecular formula of 2,7-Diiodoxanthone? |
| A: Molecular formula of 2,7-Diiodoxanthone is C13H6I2O2. |
| Q: What is the InChIKey of 2,7-Diiodoxanthone? |
| A: InChIKey of 2,7-Diiodoxanthone is GATAYWCCGFGSAI-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 2,7-Diiodoxanthone? |
| A: Molecular weight of 2,7-Diiodoxanthone is 447.99. |
| Q: What is the CAS number of 2,7-Diiodoxanthone? |
| A: CAS number of 2,7-Diiodoxanthone is 55103-03-2. |
| Q: What is the Chinese name of 55103-03-2? |
| A: Chinese name of 55103-03-2 is 55103-03-2. |