2-[(4-chloroanilino)methylidene]-5,5-dimethylcyclohexane-1,3-dione structure
|
Common Name | 2-[(4-chloroanilino)methylidene]-5,5-dimethylcyclohexane-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 55118-85-9 | Molecular Weight | 277.74600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H16ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[(4-chloroanilino)methylidene]-5,5-dimethylcyclohexane-1,3-dione |
|---|
| Molecular Formula | C15H16ClNO2 |
|---|---|
| Molecular Weight | 277.74600 |
| Exact Mass | 277.08700 |
| PSA | 46.17000 |
| LogP | 3.66700 |
| InChIKey | UDESWNJHWHTLQO-UHFFFAOYSA-N |
| SMILES | CC1(C)CC(=O)C(C=Nc2ccc(Cl)cc2)=C(O)C1 |
| HS Code | 2922399090 |
|---|
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |