Z-Gly-Phe-NH2 structure
|
Common Name | Z-Gly-Phe-NH2 | ||
|---|---|---|---|---|
| CAS Number | 5513-69-9 | Molecular Weight | 355.38800 | |
| Density | 1.247g/cm3 | Boiling Point | 683.3ºC at 760mmHg | |
| Molecular Formula | C19H21N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 367ºC | |
| Name | z-gly-phe-nh2 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.247g/cm3 |
|---|---|
| Boiling Point | 683.3ºC at 760mmHg |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.38800 |
| Flash Point | 367ºC |
| Exact Mass | 355.15300 |
| PSA | 110.52000 |
| LogP | 2.60770 |
| Index of Refraction | 1.588 |
| InChIKey | QGZDXQHLEQAGJB-INIZCTEOSA-N |
| SMILES | NC(=O)C(Cc1ccccc1)NC(=O)CNC(=O)OCc1ccccc1 |
| HS Code | 2924299090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 3 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Name: Toxicity was evaluated for the compound at a concentration of 0.282 mM against P-185 ...
Source: ChEMBL
Target: Mus musculus
External Id: CHEMBL745433
|
|
Name: Toxicity toward P-815 Mastocytoma cells after 5 hr was determined as percent of [51Cr...
Source: ChEMBL
Target: Mus musculus
External Id: CHEMBL731407
|
| Z-GLYCYL-L-PHENYLALANINE AMIDE |
| BENZYLOXYCARBONYLGLYCYL-L-PHENYLALANINE AMIDE |
| N-cbz-gly-phe amide |
| carbobenzoxyglycylphenylalanine amide |