for-asp(obzl)-oh structure
|
Common Name | for-asp(obzl)-oh | ||
|---|---|---|---|---|
| CAS Number | 5513-72-4 | Molecular Weight | 251.23500 | |
| Density | 1.302g/cm3 | Boiling Point | 530.3ºC at 760mmHg | |
| Molecular Formula | C12H13NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 274.5ºC | |
| Name | for-asp(obzl)-oh |
|---|---|
| Synonym | More Synonyms |
| Density | 1.302g/cm3 |
|---|---|
| Boiling Point | 530.3ºC at 760mmHg |
| Molecular Formula | C12H13NO5 |
| Molecular Weight | 251.23500 |
| Flash Point | 274.5ºC |
| Exact Mass | 251.07900 |
| PSA | 92.70000 |
| LogP | 1.34590 |
| Index of Refraction | 1.549 |
| InChIKey | ZPCUHIBUEFGPCP-JTQLQIEISA-N |
| SMILES | O=CNC(CC(=O)OCc1ccccc1)C(=O)O |
| HS Code | 2924299090 |
|---|
|
~%
for-asp(obzl)-oh CAS#:5513-72-4 |
| Literature: Hayakawa; Harada; Fox Bulletin of the Chemical Society of Japan, 1966 , vol. 39, # 2 p. 391 - 395 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-Formyl-L-aspartic acid 4-benzyl ester |
| 4-benzyl hydrogen N-formyl-L-aspartate |