3-[4-(1,1-Dimethylethyl)-2-(2-propenyl)phenoxy]-1,2-propanediol structure
|
Common Name | 3-[4-(1,1-Dimethylethyl)-2-(2-propenyl)phenoxy]-1,2-propanediol | ||
|---|---|---|---|---|
| CAS Number | 55143-11-8 | Molecular Weight | 264.36000 | |
| Density | 1.045g/cm3 | Boiling Point | 397.3ºC at 760 mmHg | |
| Molecular Formula | C16H24O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.1ºC | |
| Name | 3-(4-tert-butyl-2-prop-2-enylphenoxy)propane-1,2-diol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.045g/cm3 |
|---|---|
| Boiling Point | 397.3ºC at 760 mmHg |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36000 |
| Flash Point | 194.1ºC |
| Exact Mass | 264.17300 |
| PSA | 49.69000 |
| LogP | 2.44460 |
| Index of Refraction | 1.525 |
| InChIKey | XPOXPTLEXHZSHD-UHFFFAOYSA-N |
| SMILES | C=CCc1cc(C(C)(C)C)ccc1OCC(O)CO |
| HS Code | 2909499000 |
|---|
|
~%
3-[4-(1,1-Dimet... CAS#:55143-11-8 |
| Literature: Auzou; Rips; Derappe; Peyroux European Journal of Medicinal Chemistry, 1974 , vol. 9, # 5 p. 548 - 554 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2909499000 |
|---|---|
| Summary | 2909499000. ether-alcohols and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 1,2-Propanediol,3-(4-(1,1-dimethylethyl)-2-(2-propenyl)phenoxy) |
| R 1359 |
| 3-(4-(1,1-Dimethylethyl)-2-(2-propenyl)phenoxy)-1,2-propanediol |