2-BROMO-4,6-DICHLORO-2,3-DIHYDRO-1H-INDEN-1-ONE structure
|
Common Name | 2-BROMO-4,6-DICHLORO-2,3-DIHYDRO-1H-INDEN-1-ONE | ||
|---|---|---|---|---|
| CAS Number | 55144-55-3 | Molecular Weight | 279.94500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H5BrCl2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-bromo-4,6-dichloro-1-indanone |
|---|
| Molecular Formula | C9H5BrCl2O |
|---|---|
| Molecular Weight | 279.94500 |
| Exact Mass | 277.89000 |
| PSA | 17.07000 |
| LogP | 3.49570 |
| InChIKey | DAIUBOUWLDZKGH-UHFFFAOYSA-N |
| SMILES | O=C1c2cc(Cl)cc(Cl)c2CC1Br |
| HS Code | 2914700090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |