2-(3-Benzyl-1,2,4-oxadiazol-5-yl)acetic acid
Modify Date: 2026-06-30 12:59:28
2-(3-Benzyl-1,2,4-oxadiazol-5-yl)acetic acid structure
|
Common Name | 2-(3-Benzyl-1,2,4-oxadiazol-5-yl)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 55152-17-5 | Molecular Weight | 218.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(3-Benzyl-1,2,4-oxadiazol-5-yl)acetic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H10N2O3 |
|---|---|
| Molecular Weight | 218.21 |
| InChIKey | UOFCMZQYBMRUDL-UHFFFAOYSA-N |
| SMILES | O=C(O)Cc1nc(Cc2ccccc2)no1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Inhibition of ALR2 in Sprague-Dawley rat lens by spectrophotometry
Source: ChEMBL
Target: N/A
External Id: CHEMBL954901
|
|
Name: Inhibition of ALR1 in Sprague-Dawley rat kidney by spectrophotometry
Source: ChEMBL
Target: N/A
External Id: CHEMBL954902
|
Total 2, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 2-(3-Benzyl-1,2,4-oxadiazol-5-yl)acetic acid? |
| A: Molecular weight of 2-(3-Benzyl-1,2,4-oxadiazol-5-yl)acetic acid is 218.21. |
| Q: What is the English name of 2-(3-Benzyl-1,2,4-oxadiazol-5-yl)acetic acid? |
| A: The English name of 2-(3-Benzyl-1,2,4-oxadiazol-5-yl)acetic acid is 2-(3-Benzyl-1,2,4-oxadiazol-5-yl)acetic acid. |
| Q: What is the InChIKey of 2-(3-Benzyl-1,2,4-oxadiazol-5-yl)acetic acid? |
| A: InChIKey of 2-(3-Benzyl-1,2,4-oxadiazol-5-yl)acetic acid is UOFCMZQYBMRUDL-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 55152-17-5? |
| A: Chinese name of 55152-17-5 is 55152-17-5. |
| Q: What is the SMILES notation of 2-(3-Benzyl-1,2,4-oxadiazol-5-yl)acetic acid? |
| A: SMILES notation of 2-(3-Benzyl-1,2,4-oxadiazol-5-yl)acetic acid is O=C(O)Cc1nc(Cc2ccccc2)no1. |
| Q: What is the molecular formula of 2-(3-Benzyl-1,2,4-oxadiazol-5-yl)acetic acid? |
| A: Molecular formula of 2-(3-Benzyl-1,2,4-oxadiazol-5-yl)acetic acid is C11H10N2O3. |
| Q: What is the CAS number of 2-(3-Benzyl-1,2,4-oxadiazol-5-yl)acetic acid? |
| A: CAS number of 2-(3-Benzyl-1,2,4-oxadiazol-5-yl)acetic acid is 55152-17-5. |