(benzylamino)-benzylimino-methanesulfinic acid
(benzylamino)-benzylimino-methanesulfinic acid structure
|
Common Name | (benzylamino)-benzylimino-methanesulfinic acid | ||
|---|---|---|---|---|
| CAS Number | 55152-76-6 | Molecular Weight | 288.36500 | |
| Density | 1.23g/cm3 | Boiling Point | 504.8ºC at 760mmHg | |
| Molecular Formula | C15H16N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 259.1ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (benzylamino)-benzyliminomethanesulfinic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 504.8ºC at 760mmHg |
| Molecular Formula | C15H16N2O2S |
| Molecular Weight | 288.36500 |
| Flash Point | 259.1ºC |
| Exact Mass | 288.09300 |
| PSA | 80.90000 |
| LogP | 3.81070 |
| InChIKey | LWUBJMAOXMTUOQ-UHFFFAOYSA-N |
| SMILES | O=S(O)C(=NCc1ccccc1)NCc1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
(benzylamino)-b... CAS#:55152-76-6 |
| Literature: Havel,J.J.; Kluttz,R.Q. Synthetic Communications, 1974 , vol. 4, p. 389 - 393 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N,N'-Dibenzyl-formamidin-sulfinsaeure |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of (benzylamino)-benzyliminomethanesulfinic acid? |
| A: Molecular weight of (benzylamino)-benzyliminomethanesulfinic acid is 288.36500. |
| Q: What is the polar surface area (PSA) of (benzylamino)-benzyliminomethanesulfinic acid? |
| A: Polar surface area (PSA) of (benzylamino)-benzyliminomethanesulfinic acid is 80.90000. |
| Q: What is the molecular formula of (benzylamino)-benzyliminomethanesulfinic acid? |
| A: Molecular formula of (benzylamino)-benzyliminomethanesulfinic acid is C15H16N2O2S. |
| Q: What is the CAS number of (benzylamino)-benzyliminomethanesulfinic acid? |
| A: CAS number of (benzylamino)-benzyliminomethanesulfinic acid is 55152-76-6. |
| Q: What is the SMILES notation of (benzylamino)-benzyliminomethanesulfinic acid? |
| A: SMILES notation of (benzylamino)-benzyliminomethanesulfinic acid is O=S(O)C(=NCc1ccccc1)NCc1ccccc1. |
| Q: What are the upstream materials of (benzylamino)-benzyliminomethanesulfinic acid? |
| A: Related upstream materials(CAS) of (benzylamino)-benzyliminomethanesulfinic acid: 1424-14-2. |
| Q: What English synonyms does (benzylamino)-benzyliminomethanesulfinic acid have? |
| A: English synonyms of (benzylamino)-benzyliminomethanesulfinic acid: N,N'-Dibenzyl-formamidin-sulfinsaeure. |
| Q: What is the Chinese name of 55152-76-6? |
| A: Chinese name of 55152-76-6 is 55152-76-6. |
| Q: What is the English name of (benzylamino)-benzyliminomethanesulfinic acid? |
| A: The English name of (benzylamino)-benzyliminomethanesulfinic acid is (benzylamino)-benzyliminomethanesulfinic acid. |
| Q: What is the LogP of (benzylamino)-benzyliminomethanesulfinic acid? |
| A: LogP of (benzylamino)-benzyliminomethanesulfinic acid is 3.81070. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |