3-(Dimethylamino)benzoic acid phenacyl ester structure
|
Common Name | 3-(Dimethylamino)benzoic acid phenacyl ester | ||
|---|---|---|---|---|
| CAS Number | 55153-17-8 | Molecular Weight | 283.32200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | phenacyl 3-(dimethylamino)benzoate |
|---|
| Molecular Formula | C17H17NO3 |
|---|---|
| Molecular Weight | 283.32200 |
| Exact Mass | 283.12100 |
| PSA | 46.61000 |
| LogP | 2.79230 |
| InChIKey | QVQZYNUIIKYFEE-UHFFFAOYSA-N |
| SMILES | CN(C)c1cccc(C(=O)OCC(=O)c2ccccc2)c1 |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |