2,6-dibromo-4-ethylidenecyclohexa-2,5-dien-1-one structure
|
Common Name | 2,6-dibromo-4-ethylidenecyclohexa-2,5-dien-1-one | ||
|---|---|---|---|---|
| CAS Number | 55182-53-1 | Molecular Weight | 277.94100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H6Br2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,6-dibromo-4-ethylidenecyclohexa-2,5-dien-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H6Br2O |
|---|---|
| Molecular Weight | 277.94100 |
| Exact Mass | 275.87900 |
| PSA | 17.07000 |
| LogP | 3.07300 |
| InChIKey | ZXYJZSZPWVSNHT-UHFFFAOYSA-N |
| SMILES | CC=C1C=C(Br)C(=O)C(Br)=C1 |
|
~%
2,6-dibromo-4-e... CAS#:55182-53-1 |
| Literature: Pospisek,J. et al. Collection of Czechoslovak Chemical Communications, 1975 , vol. 40, p. 142 - 148 |
|
~%
2,6-dibromo-4-e... CAS#:55182-53-1 |
| Literature: Pospisek,J. et al. Collection of Czechoslovak Chemical Communications, 1975 , vol. 40, p. 142 - 148 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-Ethyliden-2,6-dibrom-2,5-cyclohexadienon |
| 2,5-Cyclohexadien-1-one,2,6-dibromo-4-ethylidene |