2-(Trimethylsiloxy)propenoic acid trimethylsilyl ester structure
|
Common Name | 2-(Trimethylsiloxy)propenoic acid trimethylsilyl ester | ||
|---|---|---|---|---|
| CAS Number | 55191-13-4 | Molecular Weight | 232.42400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H20O3Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trimethylsilyl 2-trimethylsilyloxyprop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H20O3Si2 |
|---|---|
| Molecular Weight | 232.42400 |
| Exact Mass | 232.09500 |
| PSA | 35.53000 |
| LogP | 2.72970 |
| InChIKey | WRBWZWGIWNGSRX-UHFFFAOYSA-N |
| SMILES | C=C(O[Si](C)(C)C)C(=O)O[Si](C)(C)C |
| HS Code | 2931900090 |
|---|
|
~93%
2-(Trimethylsil... CAS#:55191-13-4 |
| Literature: Sekine, Mitsuo; Futatsugi, Tetsuaki; Yamada, Kohji; Hata, Tsujiaki Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1982 , # 11 p. 2509 - 2514 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| trimethylsilyl 2-(trimethylsiloxy)-2-propenoate |
| trimethylsilyl 2-<(trimethylsilyl)oxy>acrylate |
| Pyruvic acid,bis(trimethylsilyl) |
| 2-Propenoic acid,2-[(trimethylsilyl)oxy]-,trimethylsilyl ester |
| trimethylsilyl 2-trimethylsilyloxypropenoate |
| 2-trimethylsilyloxy-2-propenoate |
| 2-((trimethylsilyl)oxy)propenoic acid trimethylsilyl ester |