3-Amino-4-(2-chlorophenyl)-6-nitro-2(1H)-quinolinone
Modify Date: 2026-07-10 20:23:21
3-Amino-4-(2-chlorophenyl)-6-nitro-2(1H)-quinolinone structure
|
Common Name | 3-Amino-4-(2-chlorophenyl)-6-nitro-2(1H)-quinolinone | ||
|---|---|---|---|---|
| CAS Number | 55198-89-5 | Molecular Weight | 315.71100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H10ClN3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-Amino-4-(2-chlorophenyl)-6-nitro-2(1H)-quinolinone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H10ClN3O3 |
|---|---|
| Molecular Weight | 315.71100 |
| Exact Mass | 315.04100 |
| PSA | 104.96000 |
| LogP | 4.85560 |
| InChIKey | GYAWOVGCEQLWHW-UHFFFAOYSA-N |
| SMILES | Nc1c(-c2ccccc2Cl)c2cc([N+](=O)[O-])ccc2[nH]c1=O |
| RIDADR | NONH for all modes of transport |
|---|---|
| HS Code | 2933499090 |
|
~59%
3-Amino-4-(2-ch... CAS#:55198-89-5 |
| Literature: Bahr; Usbeck Pharmazie, 1981 , vol. 36, # 10 p. 668 - 671 |
|
~%
3-Amino-4-(2-ch... CAS#:55198-89-5 |
| Literature: Bahr; Usbeck Pharmazie, 1981 , vol. 36, # 10 p. 668 - 671 |
|
~%
3-Amino-4-(2-ch... CAS#:55198-89-5 |
| Literature: Bahr; Usbeck Pharmazie, 1981 , vol. 36, # 10 p. 668 - 671 |
![2-amino-N-[2-(2-chlorobenzoyl)-4-nitrophenyl]acetamide structure](https://image.chemsrc.com/caspic/272/17714-02-2.png)
![9b-(2-Chlorphenyl)-2,2-dimethyl-8-nitro-2,3,3a,9b-tetrahydro-5H-oxazolo[4,5-c]chinolin-4-on structure](https://image.chemsrc.com/caspic/060/80837-70-3.png)
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-amino-4-(2-chlorophenyl)-6-nitro-1H-quinolin-2-one |