2,4-Dihydroxy-3-[(2-hydroxy-4-methoxy-6-propylbenzoyl)oxy]-6-pentylbenzoic acid structure
|
Common Name | 2,4-Dihydroxy-3-[(2-hydroxy-4-methoxy-6-propylbenzoyl)oxy]-6-pentylbenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 552-56-7 | Molecular Weight | 432.46400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H28O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,4-dihydroxy-3-(2-hydroxy-4-methoxy-6-propyl-benzoyloxy)-6-pentyl-benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C23H28O8 |
|---|---|
| Molecular Weight | 432.46400 |
| Exact Mass | 432.17800 |
| PSA | 133.52000 |
| LogP | 4.41460 |
| InChIKey | OBTGVDPYKOUXDZ-UHFFFAOYSA-N |
| SMILES | CCCCCc1cc(O)c(OC(=O)c2c(O)cc(OC)cc2CCC)c(O)c1C(=O)O |
| HS Code | 2918990090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Ramalinolsaeure |
| 2,4-Dihydroxy-3-(2-hydroxy-4-methoxy-6-propyl-benzoyloxy)-6-pentyl-benzoesaeure |