ethyl N-(4-acetylphenyl)carbamate structure
|
Common Name | ethyl N-(4-acetylphenyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 5520-79-6 | Molecular Weight | 207.22600 | |
| Density | 1.171g/cm3 | Boiling Point | 294.1ºC at 760 mmHg | |
| Molecular Formula | C11H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 131.7ºC | |
| Name | ethyl N-(4-acetylphenyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.171g/cm3 |
|---|---|
| Boiling Point | 294.1ºC at 760 mmHg |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.22600 |
| Flash Point | 131.7ºC |
| Exact Mass | 207.09000 |
| PSA | 55.40000 |
| LogP | 2.53060 |
| Index of Refraction | 1.556 |
| InChIKey | YAVJICIKBWUEAJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Nc1ccc(C(C)=O)cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-Acetyl-carbanilsaeure-aethylester |
| ethyl (4-acetylphenyl)carbamate |
| (4-Acetyl-phenyl)-carbamidsaeure-aethylester |
| 4-Carbaethoxyamino-acetophenon |
| 4-ethoxycarbonylaminoacetophenone |
| (4-acetylphenyl)carbamic acid ethyl ester |
| p-Acetyl-phenyl-urethan |
| carbamic acid,n-(4-acetylphenyl)-,ethyl ester |