N,N-Dimethyl-5-(pentyloxy)-1-phenyl-1H-pyrazole-3-carboxamide
Modify Date: 2025-10-04 19:13:17
N,N-Dimethyl-5-(pentyloxy)-1-phenyl-1H-pyrazole-3-carboxamide structure
|
Common Name | N,N-Dimethyl-5-(pentyloxy)-1-phenyl-1H-pyrazole-3-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 55227-81-1 | Molecular Weight | 301.38300 | |
| Density | 1.08g/cm3 | Boiling Point | 468.2ºC at 760 mmHg | |
| Molecular Formula | C17H23N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 237ºC | |
| Name | N,N-dimethyl-5-pentoxy-1-phenylpyrazole-3-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.08g/cm3 |
|---|---|
| Boiling Point | 468.2ºC at 760 mmHg |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.38300 |
| Flash Point | 237ºC |
| Exact Mass | 301.17900 |
| PSA | 47.36000 |
| LogP | 3.14310 |
| Index of Refraction | 1.552 |
| InChIKey | OGBLRSUWNPZVTI-UHFFFAOYSA-N |
| SMILES | CCCCCOc1cc(C(=O)N(C)C)nn1-c1ccccc1 |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-pentyloxy-1-phenyl-1H-pyrazole-3-carboxylic acid dimethylamide |
| N,N-Dimethyl-5-(pentyloxy)-1-phenyl-1H-pyrazole-3-carboxamide |
| N,N-DIMETHYL-5-PENTOXY-1-PHENYL-PYRAZOLE-3-CARBOXAMIDE |
| 1H-Pyrazole-3-carboxamide,N,N-dimethyl-5-(pentyloxy)-1-phenyl |