5-Butoxy-N-butyl-1-phenyl-1H-pyrazole-3-carboxamide structure
|
Common Name | 5-Butoxy-N-butyl-1-phenyl-1H-pyrazole-3-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 55228-47-2 | Molecular Weight | 315.41000 | |
| Density | 1.09g/cm3 | Boiling Point | 480.2ºC at 760 mmHg | |
| Molecular Formula | C18H25N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 244.2ºC | |
| Name | 5-butoxy-N-butyl-1-phenylpyrazole-3-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.09g/cm3 |
|---|---|
| Boiling Point | 480.2ºC at 760 mmHg |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.41000 |
| Flash Point | 244.2ºC |
| Exact Mass | 315.19500 |
| PSA | 59.64000 |
| LogP | 4.15590 |
| Index of Refraction | 1.555 |
| InChIKey | XEGGIQBCXBHPIQ-UHFFFAOYSA-N |
| SMILES | CCCCNC(=O)c1cc(OCCCC)n(-c2ccccc2)n1 |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Butoxy-N-butyl-1-phenyl-1H-pyrazole-3-carboxamide |
| 5-butoxy-1-phenyl-1H-pyrazole-3-carboxylic acid butylamide |
| 1H-Pyrazole-3-carboxamide,5-butoxy-N-butyl-1-phenyl |