[5-(4-methoxy-benzyloxy)-pyridin-3-yl]-carbamic acid tert-butyl ester
Modify Date: 2026-06-27 12:43:05
![[5-(4-methoxy-benzyloxy)-pyridin-3-yl]-carbamic acid tert-butyl ester Structure](https://image.chemsrc.com/caspic/249/552331-75-6.png)
[5-(4-methoxy-benzyloxy)-pyridin-3-yl]-carbamic acid tert-butyl ester structure
|
Common Name | [5-(4-methoxy-benzyloxy)-pyridin-3-yl]-carbamic acid tert-butyl ester | ||
|---|---|---|---|---|
| CAS Number | 552331-75-6 | Molecular Weight | 330.37800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H22N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [5-(4-methoxy-benzyloxy)-pyridin-3-yl]-carbamic acid tert-butyl ester |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H22N2O4 |
|---|---|
| Molecular Weight | 330.37800 |
| Exact Mass | 330.15800 |
| PSA | 69.68000 |
| LogP | 4.08920 |
| InChIKey | OVSIDPNVFGLCCI-UHFFFAOYSA-N |
| SMILES | COc1ccc(COc2cncc(NC(=O)OC(C)(C)C)c2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 552331-75-6? |
| A: Chinese name of 552331-75-6 is 552331-75-6. |
| Q: What is the SMILES notation of [5-(4-methoxy-benzyloxy)-pyridin-3-yl]-carbamic acid tert-butyl ester? |
| A: SMILES notation of [5-(4-methoxy-benzyloxy)-pyridin-3-yl]-carbamic acid tert-butyl ester is COc1ccc(COc2cncc(NC(=O)OC(C)(C)C)c2)cc1. |
| Q: What is the CAS number of [5-(4-methoxy-benzyloxy)-pyridin-3-yl]-carbamic acid tert-butyl ester? |
| A: CAS number of [5-(4-methoxy-benzyloxy)-pyridin-3-yl]-carbamic acid tert-butyl ester is 552331-75-6. |
| Q: What is the LogP of [5-(4-methoxy-benzyloxy)-pyridin-3-yl]-carbamic acid tert-butyl ester? |
| A: LogP of [5-(4-methoxy-benzyloxy)-pyridin-3-yl]-carbamic acid tert-butyl ester is 4.08920. |
| Q: What is the molecular weight of [5-(4-methoxy-benzyloxy)-pyridin-3-yl]-carbamic acid tert-butyl ester? |
| A: Molecular weight of [5-(4-methoxy-benzyloxy)-pyridin-3-yl]-carbamic acid tert-butyl ester is 330.37800. |
| Q: What is the polar surface area (PSA) of [5-(4-methoxy-benzyloxy)-pyridin-3-yl]-carbamic acid tert-butyl ester? |
| A: Polar surface area (PSA) of [5-(4-methoxy-benzyloxy)-pyridin-3-yl]-carbamic acid tert-butyl ester is 69.68000. |
| Q: What is the InChIKey of [5-(4-methoxy-benzyloxy)-pyridin-3-yl]-carbamic acid tert-butyl ester? |
| A: InChIKey of [5-(4-methoxy-benzyloxy)-pyridin-3-yl]-carbamic acid tert-butyl ester is OVSIDPNVFGLCCI-UHFFFAOYSA-N. |
| Q: What is the English name of [5-(4-methoxy-benzyloxy)-pyridin-3-yl]-carbamic acid tert-butyl ester? |
| A: The English name of [5-(4-methoxy-benzyloxy)-pyridin-3-yl]-carbamic acid tert-butyl ester is [5-(4-methoxy-benzyloxy)-pyridin-3-yl]-carbamic acid tert-butyl ester. |
| Q: What is the molecular formula of [5-(4-methoxy-benzyloxy)-pyridin-3-yl]-carbamic acid tert-butyl ester? |
| A: Molecular formula of [5-(4-methoxy-benzyloxy)-pyridin-3-yl]-carbamic acid tert-butyl ester is C18H22N2O4. |