7-ethyl-3-methyl-purine-2,6-dione structure
|
Common Name | 7-ethyl-3-methyl-purine-2,6-dione | ||
|---|---|---|---|---|
| CAS Number | 55242-68-7 | Molecular Weight | 194.19100 | |
| Density | 1.51g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8H10N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 7-ethyl-3-methylpurine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.51g/cm3 |
|---|---|
| Molecular Formula | C8H10N4O2 |
| Molecular Weight | 194.19100 |
| Exact Mass | 194.08000 |
| PSA | 72.68000 |
| Index of Refraction | 1.702 |
| InChIKey | GISWGHGEIIOKGX-UHFFFAOYSA-N |
| SMILES | CCn1cnc2c1c(=O)[nH]c(=O)n2C |
|
~%
7-ethyl-3-methy... CAS#:55242-68-7 |
| Literature: Ueda, Taisei; Oda, Noriichi; Sakakibara, Jinsaku; Takeya, Kazumi Heterocycles, 1982 , vol. 19, # 12 p. 2291 - 2294 |
|
~%
7-ethyl-3-methy... CAS#:55242-68-7 |
| Literature: Fujii; Saito; Tamura Chemical and Pharmaceutical Bulletin, 1991 , vol. 39, # 11 p. 2855 - 2862 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 7-ethyl-3-methylxanthine |
| 7-Aethyl-3-methyl-3,7-dihydro-purin-2,6-dion |
| 7-ethyl-3-methyl-3,7-dihydro-purine-2,6-dione |
| 3-methyl-7-ethyl-xanthine |
| 7-ethyl-3-methyl-1,3,7-trihydropurine-2,6-dione |