Nebidrazine structure
|
Common Name | Nebidrazine | ||
|---|---|---|---|---|
| CAS Number | 55248-23-2 | Molecular Weight | 271.10600 | |
| Density | 1.637g/cm3 | Boiling Point | 487.746ºC at 760 mmHg | |
| Molecular Formula | C9H8Cl2N6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 248.78ºC | |
| Name | 3-N-[(E)-(2,6-dichlorophenyl)methylideneamino]-1,2,4-triazole-3,4-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.637g/cm3 |
|---|---|
| Boiling Point | 487.746ºC at 760 mmHg |
| Molecular Formula | C9H8Cl2N6 |
| Molecular Weight | 271.10600 |
| Flash Point | 248.78ºC |
| Exact Mass | 270.01900 |
| PSA | 81.12000 |
| LogP | 2.39890 |
| Index of Refraction | 1.732 |
| InChIKey | KHCYGOIWSWLPNL-YIXHJXPBSA-N |
| SMILES | Nn1cnnc1NN=Cc1c(Cl)cccc1Cl |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Nebidrazina |
| FLA-136 |
| Nebidrazinum |
| Nebidrazine |