5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one
5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one structure
|
Common Name | 5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one | ||
|---|---|---|---|---|
| CAS Number | 55252-75-0 | Molecular Weight | 184.27500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H20O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H20O2 |
|---|---|
| Molecular Weight | 184.27500 |
| Exact Mass | 184.14600 |
| PSA | 37.30000 |
| LogP | 3.08960 |
| InChIKey | SOZFXLUMSLXZFW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)C=C(O)C(C)(C)C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
5-hydroxy-2,2,6... CAS#:55252-75-0 |
| Literature: Adams; Hauser Journal of the American Chemical Society, 1944 , vol. 66, p. 1222 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:39516-78-4This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| (Z)-5-hydroxy-2,2,6,6-tetramethyl-hept-4-en-3-one |
| 4-Hepten-3-one,5-hydroxy-2,2,6,6-tetramethyl |
| tetramethylheptanedione |
| 2,2,6,6-tetramethyl-heptane-3,5-dione,enol form |
| Dipivaloylmethan |
| 2,2,6,6-tetramethyl-3-hydroxy-hept-3-en-5-one |
| 2,2,6,6-tetramethyl-3,5-heptanedione |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of 5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one? |
| A: Related downstream products(CAS) of 5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one: 39516-78-4. |
| Q: What is the molecular formula of 5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one? |
| A: Molecular formula of 5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one is C11H20O2. |
| Q: What is the CAS number of 5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one? |
| A: CAS number of 5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one is 55252-75-0. |
| Q: What is the polar surface area (PSA) of 5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one? |
| A: Polar surface area (PSA) of 5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one is 37.30000. |
| Q: What is the Chinese name of 55252-75-0? |
| A: Chinese name of 55252-75-0 is 55252-75-0. |
| Q: What is the LogP of 5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one? |
| A: LogP of 5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one is 3.08960. |
| Q: What English synonyms does 5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one have? |
| A: English synonyms of 5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one: (Z)-5-hydroxy-2,2,6,6-tetramethyl-hept-4-en-3-one, 4-Hepten-3-one,5-hydroxy-2,2,6,6-tetramethyl, tetramethylheptanedione, 2,2,6,6-tetramethyl-heptane-3,5-dione,enol form, Dipivaloylmethan, 2,2,6,6-tetramethyl-3-hydroxy-hept-3-en-5-one, 2,2,6,6-tetramethyl-3,5-heptanedione. |
| Q: What is the molecular weight of 5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one? |
| A: Molecular weight of 5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one is 184.27500. |
| Q: What are the upstream materials of 5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one? |
| A: Related upstream materials(CAS) of 5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one: 75-97-8;3938-95-2. |
| Q: What is the English name of 5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one? |
| A: The English name of 5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one is 5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one. |