5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one structure
|
Common Name | 5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one | ||
|---|---|---|---|---|
| CAS Number | 55252-75-0 | Molecular Weight | 184.27500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H20O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H20O2 |
|---|---|
| Molecular Weight | 184.27500 |
| Exact Mass | 184.14600 |
| PSA | 37.30000 |
| LogP | 3.08960 |
| InChIKey | SOZFXLUMSLXZFW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)C=C(O)C(C)(C)C |
|
~%
5-hydroxy-2,2,6... CAS#:55252-75-0 |
| Literature: Adams; Hauser Journal of the American Chemical Society, 1944 , vol. 66, p. 1222 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| (Z)-5-hydroxy-2,2,6,6-tetramethyl-hept-4-en-3-one |
| 4-Hepten-3-one,5-hydroxy-2,2,6,6-tetramethyl |
| tetramethylheptanedione |
| 2,2,6,6-tetramethyl-heptane-3,5-dione,enol form |
| Dipivaloylmethan |
| 2,2,6,6-tetramethyl-3-hydroxy-hept-3-en-5-one |
| 2,2,6,6-tetramethyl-3,5-heptanedione |