1,3,5-tris(4-ethylphenyl)benzene structure
|
Common Name | 1,3,5-tris(4-ethylphenyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 55255-72-6 | Molecular Weight | 390.55900 | |
| Density | 1.017g/cm3 | Boiling Point | 527.8ºC at 760 mmHg | |
| Molecular Formula | C30H30 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 274.3ºC | |
| Name | 1,3,5-tris(4-ethylphenyl)benzene |
|---|
| Density | 1.017g/cm3 |
|---|---|
| Boiling Point | 527.8ºC at 760 mmHg |
| Molecular Formula | C30H30 |
| Molecular Weight | 390.55900 |
| Flash Point | 274.3ºC |
| Exact Mass | 390.23500 |
| LogP | 8.37480 |
| Index of Refraction | 1.585 |
| InChIKey | BUYBVSFUTSYONA-UHFFFAOYSA-N |
| SMILES | CCc1ccc(-c2cc(-c3ccc(CC)cc3)cc(-c3ccc(CC)cc3)c2)cc1 |
| HS Code | 2902909090 |
|---|
|
~82%
1,3,5-tris(4-et... CAS#:55255-72-6 |
| Literature: Xu, Yan-Li; Pan, Ying-Ming; Wu, Qiang; Wang, Heng-Shan; Liu, Pei-Zhen Journal of Organic Chemistry, 2011 , vol. 76, # 20 p. 8472 - 8476 |
|
~%
1,3,5-tris(4-et... CAS#:55255-72-6 |
| Literature: Lyle et al. Journal of the American Chemical Society, 1953 , vol. 75, p. 5959 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2902909090 |
|---|---|
| Summary | 2902909090 other aromatic hydrocarbons。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:2.0%。General tariff:30.0% |