N-(3-acetylphenyl)-3-(methoxymethyl)-1-benzofuran-2-carboxamide structure
|
Common Name | N-(3-acetylphenyl)-3-(methoxymethyl)-1-benzofuran-2-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 5526-61-4 | Molecular Weight | 323.34300 | |
| Density | 1.5g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C19H17NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(3-acetylphenyl)-3-(methoxymethyl)-1-benzofuran-2-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5g/cm3 |
|---|---|
| Molecular Formula | C19H17NO4 |
| Molecular Weight | 323.34300 |
| Exact Mass | 323.11600 |
| PSA | 72.03000 |
| LogP | 4.41810 |
| Index of Refraction | 1.709 |
| InChIKey | ASGCQODRFSUELH-UHFFFAOYSA-N |
| SMILES | COCc1c(C(=O)Nc2cccc(C(C)=O)c2)oc2ccccc12 |
|
~69%
N-(3-acetylphen... CAS#:5526-61-4 |
| Literature: Flores, Maria Celia; Beller, Nicholas R.; Castrillon, Jose Journal of Heterocyclic Chemistry, 1984 , vol. 21, p. 1737 - 1739 |
|
~83%
N-(3-acetylphen... CAS#:5526-61-4 |
| Literature: Landek, Ivana Ozimec; Pesic, Dijana; Trojko, Rudolf; Bogdanovic, Maja Devcic; Mercep, Mladen; Mesic, Milan Heterocycles, 2010 , vol. 81, # 10 p. 2269 - 2290 |
| N-(3-acetylphenyl)-3-(methoxymethyl)benzofuran-2-carboxamide |
| 2-(naphthalene-1-ylsulfanyl)-benzoic acid |
| 2-(1-naphthylthio)benzoic acid |
| 2-[1]naphthylsulfanyl-benzoic acid |
| 2-[1]Naphthylmercapto-benzoesaeure |