N-Trimethylsilyl-L-aspartic acid bis(trimethylsilyl) ester
Modify Date: 2025-09-26 22:14:24
N-Trimethylsilyl-L-aspartic acid bis(trimethylsilyl) ester structure
|
Common Name | N-Trimethylsilyl-L-aspartic acid bis(trimethylsilyl) ester | ||
|---|---|---|---|---|
| CAS Number | 55268-53-6 | Molecular Weight | 349.64600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H31NO4Si3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | bis(trimethylsilyl) (2S)-2-(trimethylsilylamino)butanedioate |
|---|
| Molecular Formula | C13H31NO4Si3 |
|---|---|
| Molecular Weight | 349.64600 |
| Exact Mass | 349.15600 |
| PSA | 64.63000 |
| LogP | 3.31670 |
| InChIKey | CTMXPIJTHHSEEF-NSHDSACASA-N |
| SMILES | C[Si](C)(C)NC(CC(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |