3-(4-Methoxyphenyl)-1H-indazole structure
|
Common Name | 3-(4-Methoxyphenyl)-1H-indazole | ||
|---|---|---|---|---|
| CAS Number | 55271-06-2 | Molecular Weight | 224.258 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 436.4±28.0 °C at 760 mmHg | |
| Molecular Formula | C14H12N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 157.1±14.3 °C | |
| Name | 3-(4-methoxyphenyl)-1H-indazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 436.4±28.0 °C at 760 mmHg |
| Molecular Formula | C14H12N2O |
| Molecular Weight | 224.258 |
| Flash Point | 157.1±14.3 °C |
| Exact Mass | 224.094955 |
| PSA | 37.91000 |
| LogP | 3.54 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.658 |
| InChIKey | TZXSAORFPSSAER-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2n[nH]c3ccccc23)cc1 |
| HS Code | 2933990090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Indazole, 3-(4-methoxyphenyl)- |
| 3-(4-Methoxyphenyl)-1H-indazole |