1-(4-chlorophenyl)-2-methyl-1-pyrimidin-5-yl-propan-1-ol structure
|
Common Name | 1-(4-chlorophenyl)-2-methyl-1-pyrimidin-5-yl-propan-1-ol | ||
|---|---|---|---|---|
| CAS Number | 55283-69-7 | Molecular Weight | 262.73500 | |
| Density | 1.219g/cm3 | Boiling Point | 407ºC at 760 mmHg | |
| Molecular Formula | C14H15ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199.9ºC | |
| Name | isopyrimol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.219g/cm3 |
|---|---|
| Boiling Point | 407ºC at 760 mmHg |
| Molecular Formula | C14H15ClN2O |
| Molecular Weight | 262.73500 |
| Flash Point | 199.9ºC |
| Exact Mass | 262.08700 |
| PSA | 46.01000 |
| LogP | 3.02190 |
| Index of Refraction | 1.578 |
| InChIKey | RKLCNSACPVMCDV-UHFFFAOYSA-N |
| SMILES | CC(C)C(O)(c1ccc(Cl)cc1)c1cncnc1 |
| HS Code | 2933599090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Isopyrimol [ANSI:ISO] |
| α-(4-chlorophenyl)-α-(1-methylethyl)-5-pyrimidinemethanol |
| (RS)-1-(4-chlorophenyl)-2-methyl-1-pyrimidin-5-ylpropan-1-ol |
| Isopyrimol [ANSI] |
| 1-(4-chlorophenyl)-2-methyl-1-pyrimidin-5-ylpropan-1-ol |
| rac-(1R)-1-(4-chlorophenyl)-2-methyl-1-(pyrimidin-5-yl)propan-1-ol |
| Isopyrimol |