(2,2-dimethyl-3H-1-benzofuran-7-yl) N-methyl-N-morpholin-4-ylsulfanylcarbamate structure
|
Common Name | (2,2-dimethyl-3H-1-benzofuran-7-yl) N-methyl-N-morpholin-4-ylsulfanylcarbamate | ||
|---|---|---|---|---|
| CAS Number | 55285-05-7 | Molecular Weight | 338.42200 | |
| Density | 1.31g/cm3 | Boiling Point | 454.3ºC at 760 mmHg | |
| Molecular Formula | C16H22N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 228.5ºC | |
| Name | (2,2-dimethyl-3H-1-benzofuran-7-yl) N-methyl-N-morpholin-4-ylsulfanylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 454.3ºC at 760 mmHg |
| Molecular Formula | C16H22N2O4S |
| Molecular Weight | 338.42200 |
| Flash Point | 228.5ºC |
| Exact Mass | 338.13000 |
| PSA | 76.54000 |
| LogP | 2.66400 |
| Index of Refraction | 1.614 |
| InChIKey | KISOXJQGSGASFJ-UHFFFAOYSA-N |
| SMILES | CN(SN1CCOCC1)C(=O)Oc1cccc2c1OC(C)(C)C2 |
| HS Code | 2934999090 |
|---|
|
~%
(2,2-dimethyl-3... CAS#:55285-05-7 |
| Literature: The Regents of the University of California Patent: US4006231 A1, 1977 ; |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| methyl-morpholin-4-ylsulfanyl-carbamic acid 2,2-dimethyl-2,3-dihydro-benzofuran-7-yl ester |