1-acetyl-5-fluoro-2,3-dihydro-3,3-dimethyl-1H-Indole
Modify Date: 2026-06-27 20:11:03
1-acetyl-5-fluoro-2,3-dihydro-3,3-dimethyl-1H-Indole structure
|
Common Name | 1-acetyl-5-fluoro-2,3-dihydro-3,3-dimethyl-1H-Indole | ||
|---|---|---|---|---|
| CAS Number | 552867-01-3 | Molecular Weight | 207.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14FNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-acetyl-5-fluoro-2,3-dihydro-3,3-dimethyl-1H-Indole |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H14FNO |
|---|---|
| Molecular Weight | 207.24 |
| InChIKey | WVAJJQJALCRFQE-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CC(C)(C)c2cc(F)ccc21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 1-acetyl-5-fluoro-2,3-dihydro-3,3-dimethyl-1H-Indole? |
| A: SMILES notation of 1-acetyl-5-fluoro-2,3-dihydro-3,3-dimethyl-1H-Indole is CC(=O)N1CC(C)(C)c2cc(F)ccc21. |
| Q: What is the CAS number of 1-acetyl-5-fluoro-2,3-dihydro-3,3-dimethyl-1H-Indole? |
| A: CAS number of 1-acetyl-5-fluoro-2,3-dihydro-3,3-dimethyl-1H-Indole is 552867-01-3. |
| Q: What is the English name of 1-acetyl-5-fluoro-2,3-dihydro-3,3-dimethyl-1H-Indole? |
| A: The English name of 1-acetyl-5-fluoro-2,3-dihydro-3,3-dimethyl-1H-Indole is 1-acetyl-5-fluoro-2,3-dihydro-3,3-dimethyl-1H-Indole. |
| Q: What is the molecular weight of 1-acetyl-5-fluoro-2,3-dihydro-3,3-dimethyl-1H-Indole? |
| A: Molecular weight of 1-acetyl-5-fluoro-2,3-dihydro-3,3-dimethyl-1H-Indole is 207.24. |
| Q: What is the Chinese name of 552867-01-3? |
| A: Chinese name of 552867-01-3 is 552867-01-3. |
| Q: What is the InChIKey of 1-acetyl-5-fluoro-2,3-dihydro-3,3-dimethyl-1H-Indole? |
| A: InChIKey of 1-acetyl-5-fluoro-2,3-dihydro-3,3-dimethyl-1H-Indole is WVAJJQJALCRFQE-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1-acetyl-5-fluoro-2,3-dihydro-3,3-dimethyl-1H-Indole? |
| A: Molecular formula of 1-acetyl-5-fluoro-2,3-dihydro-3,3-dimethyl-1H-Indole is C12H14FNO. |