Ethyl (2-Nitropyridin-3-Yl)Carbamate structure
|
Common Name | Ethyl (2-Nitropyridin-3-Yl)Carbamate | ||
|---|---|---|---|---|
| CAS Number | 55304-91-1 | Molecular Weight | 211.17500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H9N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl N-(2-nitropyridin-3-yl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H9N3O4 |
|---|---|
| Molecular Weight | 211.17500 |
| Exact Mass | 211.05900 |
| PSA | 100.53000 |
| LogP | 2.09500 |
| InChIKey | XGALXMZZDNGYGW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Nc1cccnc1[N+](=O)[O-] |
| HS Code | 2933399090 |
|---|
|
~69%
Ethyl (2-Nitrop... CAS#:55304-91-1 |
| Literature: Andrews, Adrian F.; Smith, David M.; Hodson, Harold F.; Thorogood, Peter B. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1982 , # 12 p. 2995 - 3006 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| ethyl N-(2-nitro-3-pyridyl)carbamate |
| (2-nitro-pyridin-3-yl)-carbamic acid ethyl ester |
| (2-Nitro-[3]pyridyl)-carbamidsaeure-aethylester |
| 2-Nitro-3-carbethoxyamino-pyridin |
| 2-Nitro-3-ethoxycarbonylamino-pyridin |