4-(1,1,2,3,3,3-hexafluoropropoxy)benzaldehyde structure
|
Common Name | 4-(1,1,2,3,3,3-hexafluoropropoxy)benzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 55321-69-2 | Molecular Weight | 272.14400 | |
| Density | 1.422g/cm3 | Boiling Point | 237.4ºC at 760 mmHg | |
| Molecular Formula | C10H6F6O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 94.7ºC | |
| Name | 4-(1,1,2,3,3,3-hexafluoropropoxy)benzaldehyde |
|---|
| Density | 1.422g/cm3 |
|---|---|
| Boiling Point | 237.4ºC at 760 mmHg |
| Molecular Formula | C10H6F6O2 |
| Molecular Weight | 272.14400 |
| Flash Point | 94.7ºC |
| Exact Mass | 272.02700 |
| PSA | 26.30000 |
| LogP | 3.37110 |
| Index of Refraction | 1.434 |
| InChIKey | NAFDJEVVAKIWJK-UHFFFAOYSA-N |
| SMILES | O=Cc1ccc(OC(F)(F)C(F)C(F)(F)F)cc1 |
| HS Code | 2913000090 |
|---|
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |