(S)-2-(4-Fluorophenyl)-3-methylbutanoic acid
Modify Date: 2025-08-20 06:40:53
(S)-2-(4-Fluorophenyl)-3-methylbutanoic acid structure
|
Common Name | (S)-2-(4-Fluorophenyl)-3-methylbutanoic acid | ||
|---|---|---|---|---|
| CAS Number | 55332-37-1 | Molecular Weight | 196.218 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 283.9±15.0 °C at 760 mmHg | |
| Molecular Formula | C11H13FO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 125.5±20.4 °C | |
| Name | (S)-2-(4-Fluorophenyl)-3-methylbutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 283.9±15.0 °C at 760 mmHg |
| Molecular Formula | C11H13FO2 |
| Molecular Weight | 196.218 |
| Flash Point | 125.5±20.4 °C |
| Exact Mass | 196.089951 |
| PSA | 37.30000 |
| LogP | 2.78 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.508 |
| InChIKey | YBQLHBYGMUXCEW-JTQLQIEISA-N |
| SMILES | CC(C)C(C(=O)O)c1ccc(F)cc1 |
| HS Code | 2916399090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:1213352-15-8| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| (S)-2-(4-FLUOROPHENYL) 3-METHYLBUTYRIC ACID |
| (S)-2-(4-Fluorophenyl)-3-Methylbutyric Acid |
| (2S)-2-(4-Fluorophenyl)-3-methylbutanoic acid |
| Benzeneacetic acid, 4-fluoro-α-(1-methylethyl)-, (αS)- |