Phenyltripropylstannane
Phenyltripropylstannane structure
|
Common Name | Phenyltripropylstannane | ||
|---|---|---|---|---|
| CAS Number | 55335-05-2 | Molecular Weight | 325.06800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H26Sn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | phenyltri-n-propylstannane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H26Sn |
|---|---|
| Molecular Weight | 325.06800 |
| Exact Mass | 326.10600 |
| LogP | 4.57240 |
| InChIKey | ZHBFNLSDCKXWLG-UHFFFAOYSA-N |
| SMILES | CCC[Sn](CCC)(CCC)c1ccccc1 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| tripropyl(phenyl)tin |
| phenyl-tripropyl stannane |
| Phenyl-tripropyl-stannan |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of phenyltri-n-propylstannane? |
| A: CAS number of phenyltri-n-propylstannane is 55335-05-2. |
| Q: What is the molecular weight of phenyltri-n-propylstannane? |
| A: Molecular weight of phenyltri-n-propylstannane is 325.06800. |
| Q: What is the Chinese name of 55335-05-2? |
| A: Chinese name of 55335-05-2 is 55335-05-2. |
| Q: What is the molecular formula of phenyltri-n-propylstannane? |
| A: Molecular formula of phenyltri-n-propylstannane is C15H26Sn. |
| Q: What is the LogP of phenyltri-n-propylstannane? |
| A: LogP of phenyltri-n-propylstannane is 4.57240. |
| Q: What is the English name of phenyltri-n-propylstannane? |
| A: The English name of phenyltri-n-propylstannane is phenyltri-n-propylstannane. |
| Q: What is the SMILES notation of phenyltri-n-propylstannane? |
| A: SMILES notation of phenyltri-n-propylstannane is CCC[Sn](CCC)(CCC)c1ccccc1. |
| Q: What is the InChIKey of phenyltri-n-propylstannane? |
| A: InChIKey of phenyltri-n-propylstannane is ZHBFNLSDCKXWLG-UHFFFAOYSA-N. |
| Q: What English synonyms does phenyltri-n-propylstannane have? |
| A: English synonyms of phenyltri-n-propylstannane: tripropyl(phenyl)tin, phenyl-tripropyl stannane, Phenyl-tripropyl-stannan. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |