thieno[3,4-d][1,3]dioxole-4,6-dicarboxylic acid structure
|
Common Name | thieno[3,4-d][1,3]dioxole-4,6-dicarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 55370-06-4 | Molecular Weight | 216.16800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H4O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | thieno[3,4-d][1,3]dioxole-4,6-dicarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H4O6S |
|---|---|
| Molecular Weight | 216.16800 |
| Exact Mass | 215.97300 |
| PSA | 121.30000 |
| LogP | 0.87320 |
| InChIKey | JABHGNUCPOQSKD-UHFFFAOYSA-N |
| SMILES | O=C(O)c1sc(C(=O)O)c2c1OCO2 |
|
~%
thieno[3,4-d][1... CAS#:55370-06-4 |
| Literature: Lomas, John S.; Adenier, Alain; Gao, Kun; Maurel, Francois; Vaissermann, Jacqueline Journal of the Chemical Society, Perkin Transactions 2, 2002 , # 2 p. 216 - 224 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3,4-Methylendioxy-2,5-thiophendicarbonsaeure |