1-[(4-ethoxyphenyl)methyl]-1,3-diazinane-2,4-dione structure
|
Common Name | 1-[(4-ethoxyphenyl)methyl]-1,3-diazinane-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 55383-99-8 | Molecular Weight | 248.27800 | |
| Density | 1.209g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H16N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[(4-ethoxyphenyl)methyl]-1,3-diazinane-2,4-dione |
|---|
| Density | 1.209g/cm3 |
|---|---|
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.27800 |
| Exact Mass | 248.11600 |
| PSA | 62.13000 |
| LogP | 1.74100 |
| Index of Refraction | 1.556 |
| InChIKey | AXXKQDRYWZMKRL-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(CN2CCC(=O)NC2=O)cc1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |