1-(4-fluorophenyl)sulfanyl-2-nitro-4-(trifluoromethyl)benzene structure
|
Common Name | 1-(4-fluorophenyl)sulfanyl-2-nitro-4-(trifluoromethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 55389-08-7 | Molecular Weight | 317.25900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H7F4NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-fluorophenyl)sulfanyl-2-nitro-4-(trifluoromethyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H7F4NO2S |
|---|---|
| Molecular Weight | 317.25900 |
| Exact Mass | 317.01300 |
| PSA | 71.12000 |
| LogP | 5.42710 |
| InChIKey | CLFNYQQQXSYZJM-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)ccc1Sc1ccc(F)cc1 |
|
~78%
1-(4-fluorophen... CAS#:55389-08-7 |
| Literature: Batterjee Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2003 , vol. 42, # 6 p. 1471 - 1477 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 8p-822 |