1,3-Dioxolan-4-one,2,5-bis(trichloromethyl)- structure
|
Common Name | 1,3-Dioxolan-4-one,2,5-bis(trichloromethyl)- | ||
|---|---|---|---|---|
| CAS Number | 554-21-2 | Molecular Weight | 322.78600 | |
| Density | 1.909g/cm3 | Boiling Point | 298.5ºC at 760mmHg | |
| Molecular Formula | C5H2Cl6O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 121.9ºC | |
| Name | 1,3-Dioxolan-4-one, 2,5-bis-trichloromethyl |
|---|---|
| Synonym | More Synonyms |
| Density | 1.909g/cm3 |
|---|---|
| Boiling Point | 298.5ºC at 760mmHg |
| Molecular Formula | C5H2Cl6O3 |
| Molecular Weight | 322.78600 |
| Flash Point | 121.9ºC |
| Exact Mass | 319.81400 |
| PSA | 35.53000 |
| LogP | 2.99490 |
| Index of Refraction | 1.562 |
| InChIKey | MURYNVIRLILSCR-UHFFFAOYSA-N |
| SMILES | O=C1OC(C(Cl)(Cl)Cl)OC1C(Cl)(Cl)Cl |
| HS Code | 2932999099 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 3 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,5-Bis-pentafluoraethyl-1,3,4-oxadiazol |
| 2,5-Bis-perfluoraethyl-1,3,4-oxadiazol |