3-nitropyrazolo[1,5-a]pyrimidine structure
|
Common Name | 3-nitropyrazolo[1,5-a]pyrimidine | ||
|---|---|---|---|---|
| CAS Number | 55405-64-6 | Molecular Weight | 164.12200 | |
| Density | 1.68g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C6H4N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-nitropyrazolo[1,5-a]pyrimidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.68g/cm3 |
|---|---|
| Molecular Formula | C6H4N4O2 |
| Molecular Weight | 164.12200 |
| Exact Mass | 164.03300 |
| PSA | 76.01000 |
| LogP | 1.16070 |
| Index of Refraction | 1.776 |
| InChIKey | FDOREHMGSRCRRM-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cnn2cccnc12 |
| HS Code | 2933990090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Nitropyrazol<1,5-a>pyrimidin |