10,14,18,22-Tetramethyltricosanoic acid methyl ester
Modify Date: 2025-08-20 19:49:58
10,14,18,22-Tetramethyltricosanoic acid methyl ester structure
|
Common Name | 10,14,18,22-Tetramethyltricosanoic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 55429-72-6 | Molecular Weight | 424.74300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H56O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 10,14,18,22-tetramethyltricosanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C28H56O2 |
|---|---|
| Molecular Weight | 424.74300 |
| Exact Mass | 424.42800 |
| PSA | 26.30000 |
| LogP | 9.35540 |
| InChIKey | DDTWEFZMKFYQQK-UHFFFAOYSA-N |
| SMILES | COC(=O)CCCCCCCCC(C)CCCC(C)CCCC(C)CCCC(C)C |
| HS Code | 2915900090 |
|---|
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| 10,14,18,22-Tetramethyltricosanoic acid methyl ester |
| Tricosanoic acid,10,14,18,22-tetramethyl-,methyl ester |
| 10,14,18,22-Tetramethyl-tricosansaeuremethylester |