3-(4-chlorophenyl)-1-phenyl-1H-pyrazole-4-acetonitrile structure
|
Common Name | 3-(4-chlorophenyl)-1-phenyl-1H-pyrazole-4-acetonitrile | ||
|---|---|---|---|---|
| CAS Number | 55432-07-0 | Molecular Weight | 293.75000 | |
| Density | 1.21g/cm3 | Boiling Point | 495.6ºC at 760 mmHg | |
| Molecular Formula | C17H12ClN3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 253.5ºC | |
| Name | 2-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]acetonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 495.6ºC at 760 mmHg |
| Molecular Formula | C17H12ClN3 |
| Molecular Weight | 293.75000 |
| Flash Point | 253.5ºC |
| Exact Mass | 293.07200 |
| PSA | 41.61000 |
| LogP | 4.25878 |
| Index of Refraction | 1.635 |
| InChIKey | SEISKGMLVBKBHK-UHFFFAOYSA-N |
| SMILES | N#CCc1cn(-c2ccccc2)nc1-c1ccc(Cl)cc1 |
| HS Code | 2933199090 |
|---|
|
~98%
3-(4-chlorophen... CAS#:55432-07-0 |
| Literature: Rainer; Krueger; Klemm Arzneimittel-Forschung/Drug Research, 1981 , vol. 31, # 4 p. 649 - 655 |
|
~%
3-(4-chlorophen... CAS#:55432-07-0 |
| Literature: Rainer; Krueger; Klemm Arzneimittel-Forschung/Drug Research, 1981 , vol. 31, # 4 p. 649 - 655 |
|
~%
3-(4-chlorophen... CAS#:55432-07-0 |
| Literature: Rainer; Krueger; Klemm Arzneimittel-Forschung/Drug Research, 1981 , vol. 31, # 4 p. 649 - 655 |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| einecs 259-635-9 |