ethyl 2-(trifluoromethyl)benzo[d]thiazole-6-carboxylate
![ethyl 2-(trifluoromethyl)benzo[d]thiazole-6-carboxylate Structure](https://image.chemsrc.com/caspic/325/55439-72-0.png)
ethyl 2-(trifluoromethyl)benzo[d]thiazole-6-carboxylate structure
|
Common Name | ethyl 2-(trifluoromethyl)benzo[d]thiazole-6-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 55439-72-0 | Molecular Weight | 275.24700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H8F3NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl 2-(trifluoromethyl)benzo[d]thiazole-6-carboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H8F3NO2S |
|---|---|
| Molecular Weight | 275.24700 |
| Exact Mass | 275.02300 |
| PSA | 67.43000 |
| LogP | 3.49180 |
| InChIKey | DCLVJHDQBOUBBK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc2nc(C(F)(F)F)sc2c1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:55439-75-3This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-trifluoromethyl-benzothiazole-6-carboxylic acid ethyl ester |
| 2-Trifluoromethyl-6-benzothiazolecarboxylic acid ethyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does ethyl 2-(trifluoromethyl)benzo[d]thiazole-6-carboxylate have? |
| A: English synonyms of ethyl 2-(trifluoromethyl)benzo[d]thiazole-6-carboxylate: 2-trifluoromethyl-benzothiazole-6-carboxylic acid ethyl ester, 2-Trifluoromethyl-6-benzothiazolecarboxylic acid ethyl ester. |
| Q: What is the Chinese name of 55439-72-0? |
| A: Chinese name of 55439-72-0 is 55439-72-0. |
| Q: What is the LogP of ethyl 2-(trifluoromethyl)benzo[d]thiazole-6-carboxylate? |
| A: LogP of ethyl 2-(trifluoromethyl)benzo[d]thiazole-6-carboxylate is 3.49180. |
| Q: What is the InChIKey of ethyl 2-(trifluoromethyl)benzo[d]thiazole-6-carboxylate? |
| A: InChIKey of ethyl 2-(trifluoromethyl)benzo[d]thiazole-6-carboxylate is DCLVJHDQBOUBBK-UHFFFAOYSA-N. |
| Q: What is the molecular weight of ethyl 2-(trifluoromethyl)benzo[d]thiazole-6-carboxylate? |
| A: Molecular weight of ethyl 2-(trifluoromethyl)benzo[d]thiazole-6-carboxylate is 275.24700. |
| Q: What is the CAS number of ethyl 2-(trifluoromethyl)benzo[d]thiazole-6-carboxylate? |
| A: CAS number of ethyl 2-(trifluoromethyl)benzo[d]thiazole-6-carboxylate is 55439-72-0. |
| Q: What are the downstream products of ethyl 2-(trifluoromethyl)benzo[d]thiazole-6-carboxylate? |
| A: Related downstream products(CAS) of ethyl 2-(trifluoromethyl)benzo[d]thiazole-6-carboxylate: 55439-75-3. |
| Q: What is the SMILES notation of ethyl 2-(trifluoromethyl)benzo[d]thiazole-6-carboxylate? |
| A: SMILES notation of ethyl 2-(trifluoromethyl)benzo[d]thiazole-6-carboxylate is CCOC(=O)c1ccc2nc(C(F)(F)F)sc2c1. |
| Q: What is the polar surface area (PSA) of ethyl 2-(trifluoromethyl)benzo[d]thiazole-6-carboxylate? |
| A: Polar surface area (PSA) of ethyl 2-(trifluoromethyl)benzo[d]thiazole-6-carboxylate is 67.43000. |
| Q: What is the molecular formula of ethyl 2-(trifluoromethyl)benzo[d]thiazole-6-carboxylate? |
| A: Molecular formula of ethyl 2-(trifluoromethyl)benzo[d]thiazole-6-carboxylate is C11H8F3NO2S. |