N-[4-(Acetylsulfamoyl)phenyl]-2,4-dichlorobenzamide structure
|
Common Name | N-[4-(Acetylsulfamoyl)phenyl]-2,4-dichlorobenzamide | ||
|---|---|---|---|---|
| CAS Number | 5544-16-1 | Molecular Weight | 387.23800 | |
| Density | 1.51g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C15H12Cl2N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[4-(Acetylsulfamoyl)phenyl]-2,4-dichlorobenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.51g/cm3 |
|---|---|
| Molecular Formula | C15H12Cl2N2O4S |
| Molecular Weight | 387.23800 |
| Exact Mass | 385.98900 |
| PSA | 104.21000 |
| LogP | 5.06460 |
| Index of Refraction | 1.631 |
| InChIKey | IMAAPPXGGBLKCQ-UHFFFAOYSA-N |
| SMILES | CC(=O)NS(=O)(=O)c1ccc(NC(=O)c2ccc(Cl)cc2Cl)cc1 |
| HS Code | 2933699090 |
|---|
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| thiophosphoric acid S-(4,6-dioxo-1,4,5,6-tetrahydro-[1,3,5]triazin-2-ylmethyl) ester O,O'-dimethyl ester |
| N-[4-(ACETYLSULFAMOYL)PHENYL]-2,4-DICHLORO-BENZAMIDE |
| S-<4.6-Dihydroxy-1.3.5-triazin-2-yl>-methyl-phosphorothiolsaeure-dimethylester |