6-amino-1-methyl-5-(methylamino)pyrimidine-2,4-dione structure
|
Common Name | 6-amino-1-methyl-5-(methylamino)pyrimidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 55441-70-8 | Molecular Weight | 170.16900 | |
| Density | 1.38g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C6H10N4O2 | Melting Point | >300ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-amino-1-methyl-5-(methylamino)pyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.38g/cm3 |
|---|---|
| Melting Point | >300ºC |
| Molecular Formula | C6H10N4O2 |
| Molecular Weight | 170.16900 |
| Exact Mass | 170.08000 |
| PSA | 92.91000 |
| Index of Refraction | 1.605 |
| InChIKey | VCMTXXSJNFBMBV-UHFFFAOYSA-N |
| SMILES | CNc1c(N)n(C)c(=O)[nH]c1=O |
| HS Code | 2933599090 |
|---|
|
~69%
6-amino-1-methy... CAS#:55441-70-8 |
| Literature: Mueller, Christa E.; Geis, Uli; Hipp, Jo; Schobert, Ulrike; Frobenius, Wolfram; Pawlowski, Maciej; Suzuki, Fumio; Sandoval-Ramirez, Jesus Journal of Medicinal Chemistry, 1997 , vol. 40, # 26 p. 4396 - 4405 |
|
~%
6-amino-1-methy... CAS#:55441-70-8 |
| Literature: Tetrahedron Letters, , vol. 47, # 5 p. 775 - 778 |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-amino-1-methyl-5-N-methylaminouracil |
| 6-amino-1-methyl-5-methylamino-1H-pyrimidine-2,4-dione |