Benzenesulfonamide,4-(3,3-diethyl-1-triazen-1-yl)- structure
|
Common Name | Benzenesulfonamide,4-(3,3-diethyl-1-triazen-1-yl)- | ||
|---|---|---|---|---|
| CAS Number | 55469-65-3 | Molecular Weight | 256.32500 | |
| Density | 1.27g/cm3 | Boiling Point | 403.9ºC at 760mmHg | |
| Molecular Formula | C10H16N4O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.1ºC | |
| Name | 4-(diethylaminodiazenyl)benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 403.9ºC at 760mmHg |
| Molecular Formula | C10H16N4O2S |
| Molecular Weight | 256.32500 |
| Flash Point | 198.1ºC |
| Exact Mass | 256.09900 |
| PSA | 96.50000 |
| LogP | 3.45560 |
| Index of Refraction | 1.586 |
| InChIKey | WDLQSZLVWSFDSH-UHFFFAOYSA-N |
| SMILES | CCN(CC)N=Nc1ccc(S(N)(=O)=O)cc1 |
|
~%
Benzenesulfonam... CAS#:55469-65-3 |
| Literature: Pearson et al. Journal of the American Chemical Society, 1950 , vol. 72, p. 2303 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-[(1E)-3,3-diethyltriaz-1-en-1-yl]benzenesulfonamide |
| 4-(3,3-diethyl-triazenyl)-benzenesulfonic acid amide |
| 4-(3,3-Diaethyl-triazenyl)-benzolsulfonsaeure-amid |