Guanidine, 1-(4,6-dimethyl-2-pyrimidinyl)-3-phenethyl- structure
|
Common Name | Guanidine, 1-(4,6-dimethyl-2-pyrimidinyl)-3-phenethyl- | ||
|---|---|---|---|---|
| CAS Number | 55474-82-3 | Molecular Weight | 269.34500 | |
| Density | 1.16g/cm3 | Boiling Point | 467.1ºC at 760 mmHg | |
| Molecular Formula | C15H19N5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 236.3ºC | |
| Name | 1-(4,6-dimethylpyrimidin-2-yl)-2-(2-phenylethyl)guanidine |
|---|
| Density | 1.16g/cm3 |
|---|---|
| Boiling Point | 467.1ºC at 760 mmHg |
| Molecular Formula | C15H19N5 |
| Molecular Weight | 269.34500 |
| Flash Point | 236.3ºC |
| Exact Mass | 269.16400 |
| PSA | 73.69000 |
| LogP | 2.83600 |
| Index of Refraction | 1.612 |
| InChIKey | FVBRWQIUJUHLKQ-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)nc(NC(N)=NCCc2ccccc2)n1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |