Deoxycorticosterone-d8 structure
|
Common Name | Deoxycorticosterone-d8 | ||
|---|---|---|---|---|
| CAS Number | 55487-63-3 | Molecular Weight | 338.510 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 488.0±45.0 °C at 760 mmHg | |
| Molecular Formula | C21H22D8O3 | Melting Point | 132-134ºC | |
| MSDS | N/A | Flash Point | 263.0±25.2 °C | |
Use of Deoxycorticosterone-d8Deoxycorticosterone-d8 is the deuterium labeled Deoxycorticosterone. Deoxycorticosterone is a steroid hormone produced by the adrenal gland that possesses mineralocorticoid activity and acts as an aldosterone precursor[1][2]. |
| Name | 11-Deoxy Corticosterone-d8 |
|---|---|
| Synonym | More Synonyms |
| Description | Deoxycorticosterone-d8 is the deuterium labeled Deoxycorticosterone. Deoxycorticosterone is a steroid hormone produced by the adrenal gland that possesses mineralocorticoid activity and acts as an aldosterone precursor[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 488.0±45.0 °C at 760 mmHg |
| Melting Point | 132-134ºC |
| Molecular Formula | C21H22D8O3 |
| Molecular Weight | 338.510 |
| Flash Point | 263.0±25.2 °C |
| Exact Mass | 338.269714 |
| PSA | 54.37000 |
| LogP | 3.41 |
| Vapour Pressure | 0.0±2.8 mmHg at 25°C |
| Index of Refraction | 1.559 |
| InChIKey | ZESRJSPZRDMNHY-JRMIWGODSA-N |
| SMILES | CC12CCC(=O)C=C1CCC1C2CCC2(C)C(C(=O)CO)CCC12 |
| 21-Hydroxy(2,2,4,6,6,17,21,21-H)pregn-4-ene-3,20-dione |
| 4-pregnen-21-ol-3,20-dione-2,2,4,6,6,17alpha,21,21-d8 |