N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-4-nitro-N-propan-2-ylbenzamide
Modify Date: 2024-09-09 23:28:57
N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-4-nitro-N-propan-2-ylbenzamide structure
|
Common Name | N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-4-nitro-N-propan-2-ylbenzamide | ||
|---|---|---|---|---|
| CAS Number | 5550-99-2 | Molecular Weight | 394.42400 | |
| Density | 1.33g/cm3 | Boiling Point | 549.2ºC at 760 mmHg | |
| Molecular Formula | C21H22N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 285.9ºC | |
| Name | N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-4-nitro-N-propan-2-ylbenzamide |
|---|
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 549.2ºC at 760 mmHg |
| Molecular Formula | C21H22N4O4 |
| Molecular Weight | 394.42400 |
| Flash Point | 285.9ºC |
| Exact Mass | 394.16400 |
| PSA | 93.06000 |
| LogP | 3.97100 |
| Index of Refraction | 1.652 |
| InChIKey | KWSBBYMTBOKFAZ-UHFFFAOYSA-N |
| SMILES | Cc1c(N(C(=O)c2ccc([N+](=O)[O-])cc2)C(C)C)c(=O)n(-c2ccccc2)n1C |
| HS Code | 2928000090 |
|---|
|
~%
N-(1,5-dimethyl... CAS#:5550-99-2 |
| Literature: Fischer,H.P.; Grob,C.A. Helvetica Chimica Acta, 1962 , vol. 45, p. 2528 - 2538 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |