p-Dithiino[2,3-d:5,6-d']dipyridazine-1,6(2H,7H)-dione, 2,7-diphenyl- (7CI,8CI) structure
|
Common Name | p-Dithiino[2,3-d:5,6-d']dipyridazine-1,6(2H,7H)-dione, 2,7-diphenyl- (7CI,8CI) | ||
|---|---|---|---|---|
| CAS Number | 5557-49-3 | Molecular Weight | 404.46500 | |
| Density | 1.51g/cm3 | Boiling Point | 528.1ºC at 760mmHg | |
| Molecular Formula | C20H12N4O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 273.2ºC | |
| Name | 2,7-diphenyl[1,4]dithiino[2,3-d:5,6-d']dipyridazine-1,6(2h,7h)-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.51g/cm3 |
|---|---|
| Boiling Point | 528.1ºC at 760mmHg |
| Molecular Formula | C20H12N4O2S2 |
| Molecular Weight | 404.46500 |
| Flash Point | 273.2ºC |
| Exact Mass | 404.04000 |
| PSA | 126.26000 |
| LogP | 3.77000 |
| Index of Refraction | 1.639 |
| InChIKey | ZGXQGELEHYNGLJ-UHFFFAOYSA-N |
| SMILES | O=c1c2c(cnn1-c1ccccc1)Sc1c(cnn(-c3ccccc3)c1=O)S2 |
| HS Code | 2934999090 |
|---|
|
~%
p-Dithiino[2,3-... CAS#:5557-49-3 |
| Literature: Castle,R.N. et al. Journal of Heterocyclic Chemistry, 1966 , vol. 3, p. 541 - 543 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,7-Diphenyl-dipyridazo<4.5-b,4.5-e>-1,4-dithiin-1,6-dion |
| 2,7-diphenyl-2H,7H-[1,4]dithiino[2,3-d,5,6-d']dipyridazine-1,6-dione |
| 2.7-Diphenyl-1.6-dioxo-1.2.6.7-tetrahydro-dipyridazo<4,5-b,4,5-e>-1.4-dithiin |
| 3.8-Diphenyl-4.9-dioxo-5.10-dithia-3.4.8.9-tetrahydro-pyridazino<4,5-g>phthalazin |